About 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol
2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol (PubChem CID 712390) has the molecular formula C15H12N2O3
and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol |
| PubChem CID | 712390 |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nnc(COc2ccccc2)o1 |
| InChI | InChI=1S/C15H12N2O3/c18-13-9-5-4-8-12(13)15-17-16-14(20-15)10-19-11-6-2-1-3-7-11/h1-9,18H,10H2 |
| InChIKey | AJEJJQMLMWCPDD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol?
The IUPAC name of 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol (CID 712390) is 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol.
What is the SMILES notation for 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol?
The canonical SMILES for 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol is Oc1ccccc1-c1nnc(COc2ccccc2)o1.
What is the InChIKey of 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol?
The InChIKey is AJEJJQMLMWCPDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3/c18-13-9-5-4-8-12(13)15-17-16-14(20-15)10-19-11-6-2-1-3-7-11/h1-9,18H,10H2.
What are the key properties of 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol?
2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol has a molecular weight of 268.27 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(phenoxymethyl)-1,3,4-oxadiazol-2-yl]phenol is sourced from PubChem (CID 712390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).