C20H22ClFN2O5S — CID 71239131
2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-5-propan-2-yl-3H-isoindole-4-sulfonamide (PubChem CID 71239131) has the molecular formula C20H22ClFN2O5S and a molecular weight of 456.92 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-5-propan-2-yl-3H-isoindole-4-sulfonamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-5-propan-2-yl-3H-isoindole-4-sulfonamide |
|---|---|
| PubChem CID | 71239131 |
| Molecular Formula | C20H22ClFN2O5S |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-5-propan-2-yl-3H-isoindole-4-sulfonamide |
| SMILES | CC(C)c1c(O)c(O)c2c(c1S(=O)(=O)N(C)C)CN(Cc1ccc(F)c(Cl)c1)C2=O |
| InChI | InChI=1S/C20H22ClFN2O5S/c1-10(2)15-17(25)18(26)16-12(19(15)30(28,29)23(3)4)9-24(20(16)27)8-11-5-6-14(22)13(21)7-11/h5-7,10,25-26H,8-9H2,1-4H3 |
| InChIKey | RQVWZQPBQDJGNY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|