C25H25ClFN3O7S2 — CID 71239177
2-[(3-chloro-4-fluorophenyl)methyl]-5-[4-(dimethylsulfamoyl)phenyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-3H-isoindole-4-sulfonamide (PubChem CID 71239177) has the molecular formula C25H25ClFN3O7S2 and a molecular weight of 598.07 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-5-[4-(dimethylsulfamoyl)phenyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-3H-isoindole-4-sulfonamide.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-5-[4-(dimethylsulfamoyl)phenyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-3H-isoindole-4-sulfonamide |
|---|---|
| PubChem CID | 71239177 |
| Molecular Formula | C25H25ClFN3O7S2 |
| Molecular Weight | 598.07 g/mol |
| Exact Mass | 597.08 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-5-[4-(dimethylsulfamoyl)phenyl]-6,7-dihydroxy-N,N-dimethyl-1-oxo-3H-isoindole-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2c(O)c(O)c3c(c2S(=O)(=O)N(C)C)CN(Cc2ccc(F)c(Cl)c2)C3=O)cc1 |
| InChI | InChI=1S/C25H25ClFN3O7S2/c1-28(2)38(34,35)16-8-6-15(7-9-16)20-22(31)23(32)21-17(24(20)39(36,37)29(3)4)13-30(25(21)33)12-14-5-10-19(27)18(26)11-14/h5-11,31-32H,12-13H2,1-4H3 |
| InChIKey | VQWGLYRTDQYVDL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.07 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|