About 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide
2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide (PubChem CID 71239567) has the molecular formula C16H12ClF3N2O2
and a molecular weight of 356.73 g/mol. Its IUPAC name is 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide |
| PubChem CID | 71239567 |
| Molecular Formula | C16H12ClF3N2O2 |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1Cl)NC1COc2ncccc21 |
| InChI | InChI=1S/C16H12ClF3N2O2/c17-14-9(3-1-5-11(14)16(18,19)20)7-13(23)22-12-8-24-15-10(12)4-2-6-21-15/h1-6,12H,7-8H2,(H,22,23) |
| InChIKey | NOLLGHUYWWIUQZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide?
The IUPAC name of 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide (CID 71239567) is 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide.
What is the SMILES notation for 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide?
The canonical SMILES for 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide is O=C(Cc1cccc(C(F)(F)F)c1Cl)NC1COc2ncccc21.
What is the InChIKey of 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide?
The InChIKey is NOLLGHUYWWIUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClF3N2O2/c17-14-9(3-1-5-11(14)16(18,19)20)7-13(23)22-12-8-24-15-10(12)4-2-6-21-15/h1-6,12H,7-8H2,(H,22,23).
What are the key properties of 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide?
2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide has a molecular weight of 356.73 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-3-(trifluoromethyl)phenyl]-N-(2,3-dihydrofuro[2,3-b]pyridin-3-yl)acetamide is sourced from PubChem (CID 71239567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).