About quinoline-2-carboxylic acid
quinoline-2-carboxylic acid (PubChem CID 7124) has the molecular formula C10H7NO2
and a molecular weight of 173.17 g/mol. Its IUPAC name is quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | quinoline-2-carboxylic acid |
| PubChem CID | 7124 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H7NO2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9/h1-6H,(H,12,13) |
| InChIKey | LOAUVZALPPNFOQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-2-carboxylic acid?
The IUPAC name of quinoline-2-carboxylic acid (CID 7124) is quinoline-2-carboxylic acid.
What is the SMILES notation for quinoline-2-carboxylic acid?
The canonical SMILES for quinoline-2-carboxylic acid is O=C(O)c1ccc2ccccc2n1.
What is the InChIKey of quinoline-2-carboxylic acid?
The InChIKey is LOAUVZALPPNFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9/h1-6H,(H,12,13).
What are the key properties of quinoline-2-carboxylic acid?
quinoline-2-carboxylic acid has a molecular weight of 173.17 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-2-carboxylic acid is sourced from PubChem (CID 7124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).