C24H26N2O5 — CID 71240317
(4R)-4-[2-[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one (PubChem CID 71240317) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is (4R)-4-[2-[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[2-[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71240317 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (4R)-4-[2-[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxyethyl]pyrrolidin-2-one |
| SMILES | COc1cc(-c2cc(OCC[C@H]3CNC(=O)C3)c3cccnc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H26N2O5/c1-28-21-12-17(13-22(29-2)24(21)30-3)16-10-19-18(5-4-7-25-19)20(11-16)31-8-6-15-9-23(27)26-14-15/h4-5,7,10-13,15H,6,8-9,14H2,1-3H3,(H,26,27)/t15-/m1/s1 |
| InChIKey | GXZOKHPSZAMSEE-OAHLLOKOSA-N |
| XLogP | 3.83 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |