C27H36N6 — CID 71240426
2-(2,6-dimethylphenyl)-4-(3,3-dimethylpiperidin-1-yl)-6-(2,5-dimethylpyrazol-3-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 71240426) has the molecular formula C27H36N6 and a molecular weight of 444.63 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-4-(3,3-dimethylpiperidin-1-yl)-6-(2,5-dimethylpyrazol-3-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 2-(2,6-dimethylphenyl)-4-(3,3-dimethylpiperidin-1-yl)-6-(2,5-dimethylpyrazol-3-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 71240426 |
| Molecular Formula | C27H36N6 |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-4-(3,3-dimethylpiperidin-1-yl)-6-(2,5-dimethylpyrazol-3-yl)-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | Cc1cc(N2CCc3nc(-c4c(C)cccc4C)nc(N4CCCC(C)(C)C4)c3C2)n(C)n1 |
| InChI | InChI=1S/C27H36N6/c1-18-9-7-10-19(2)24(18)25-28-22-11-14-32(23-15-20(3)30-31(23)6)16-21(22)26(29-25)33-13-8-12-27(4,5)17-33/h7,9-10,15H,8,11-14,16-17H2,1-6H3 |
| InChIKey | MDDPAAWKBVOSME-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |