C14H9FN2O — CID 712408
2-(4-fluorophenyl)imidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 712408) has the molecular formula C14H9FN2O and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-(4-fluorophenyl)imidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2-(4-fluorophenyl)imidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 712408 |
| Molecular Formula | C14H9FN2O |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(4-fluorophenyl)imidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | O=Cc1c(-c2ccc(F)cc2)nc2ccccn12 |
| InChI | InChI=1S/C14H9FN2O/c15-11-6-4-10(5-7-11)14-12(9-18)17-8-2-1-3-13(17)16-14/h1-9H |
| InChIKey | UNQZNGMFGRJLEG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|