C52H54N6O6 — CID 71241530
2-[4-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]phenyl]-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole (PubChem CID 71241530) has the molecular formula C52H54N6O6 and a molecular weight of 859.04 g/mol. Its IUPAC name is 2-[4-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]phenyl]-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole.
| Compound Name | 2-[4-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]phenyl]-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 71241530 |
| Molecular Formula | C52H54N6O6 |
| Molecular Weight | 859.04 g/mol |
| Exact Mass | 858.41 |
| IUPAC Name | 2-[4-[2-[2-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethoxy]ethoxy]ethoxy]phenyl]-6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazole |
| SMILES | COc1ccc(C(OCCOCCOCCOc2ccc(-c3nc4ccc(-c5nc6ccc(N7CCN(C)CC7)cc6[nH]5)cc4[nH]3)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C52H54N6O6/c1-57-25-27-58(28-26-57)42-16-24-47-49(36-42)56-51(54-47)38-11-23-46-48(35-38)55-50(53-46)37-9-17-45(18-10-37)63-33-31-61-29-30-62-32-34-64-52(39-7-5-4-6-8-39,40-12-19-43(59-2)20-13-40)41-14-21-44(60-3)22-15-41/h4-24,35-36H,25-34H2,1-3H3,(H,53,55)(H,54,56) |
| InChIKey | CJZYXFJFLPZTMR-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.04 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|