C43H51ClN6O2 — CID 71241691
15-[4-[4-[4-[2-(2-benzyl-4,5-dimethoxyphenyl)ethylamino]butyl]triazol-1-yl]butyl]-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine (PubChem CID 71241691) has the molecular formula C43H51ClN6O2 and a molecular weight of 719.37 g/mol. Its IUPAC name is 15-[4-[4-[4-[2-(2-benzyl-4,5-dimethoxyphenyl)ethylamino]butyl]triazol-1-yl]butyl]-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine.
| Compound Name | 15-[4-[4-[4-[2-(2-benzyl-4,5-dimethoxyphenyl)ethylamino]butyl]triazol-1-yl]butyl]-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
|---|---|
| PubChem CID | 71241691 |
| Molecular Formula | C43H51ClN6O2 |
| Molecular Weight | 719.37 g/mol |
| Exact Mass | 718.38 |
| IUPAC Name | 15-[4-[4-[4-[2-(2-benzyl-4,5-dimethoxyphenyl)ethylamino]butyl]triazol-1-yl]butyl]-7-chloro-10-azatetracyclo[11.3.1.02,11.04,9]heptadeca-2,4(9),5,7,10,14-hexaen-3-amine |
| SMILES | COc1cc(CCNCCCCc2cn(CCCCC3=CC4Cc5nc6cc(Cl)ccc6c(N)c5C(C3)C4)nn2)c(Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C43H51ClN6O2/c1-51-40-25-32(33(26-41(40)52-2)21-29-10-4-3-5-11-29)16-18-46-17-8-6-13-36-28-50(49-48-36)19-9-7-12-30-20-31-23-34(22-30)42-39(24-31)47-38-27-35(44)14-15-37(38)43(42)45/h3-5,10-11,14-15,20,25-28,31,34,46H,6-9,12-13,16-19,21-24H2,1-2H3,(H2,45,47) |
| InChIKey | FBZHQUQVRMYLGQ-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.37 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|