C30H39N5O3 — CID 71241720
(2R)-2-cyclopentyl-2-[2-(2,6-diethyl-4-pyridinyl)ethyl]-4-hydroxy-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one (PubChem CID 71241720) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is (2R)-2-cyclopentyl-2-[2-(2,6-diethyl-4-pyridinyl)ethyl]-4-hydroxy-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one.
| Compound Name | (2R)-2-cyclopentyl-2-[2-(2,6-diethyl-4-pyridinyl)ethyl]-4-hydroxy-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one |
|---|---|
| PubChem CID | 71241720 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | (2R)-2-cyclopentyl-2-[2-(2,6-diethyl-4-pyridinyl)ethyl]-4-hydroxy-5-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-3H-pyran-6-one |
| SMILES | CCc1cc(CC[C@]2(C3CCCC3)CC(O)=C(Cc3nc4nc(C)c(C)c(C)n4n3)C(=O)O2)cc(CC)n1 |
| InChI | InChI=1S/C30H39N5O3/c1-6-23-14-21(15-24(7-2)32-23)12-13-30(22-10-8-9-11-22)17-26(36)25(28(37)38-30)16-27-33-29-31-19(4)18(3)20(5)35(29)34-27/h14-15,22,36H,6-13,16-17H2,1-5H3/t30-/m1/s1 |
| InChIKey | MIFNFCBCPZIDHA-SSEXGKCCSA-N |
| XLogP | 5.43 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |