C24H33NO3S — CID 71241828
(3R,5R)-3-butyl-3,8-diethyl-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide (PubChem CID 71241828) has the molecular formula C24H33NO3S and a molecular weight of 415.60 g/mol. Its IUPAC name is (3R,5R)-3-butyl-3,8-diethyl-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide.
| Compound Name | (3R,5R)-3-butyl-3,8-diethyl-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide |
|---|---|
| PubChem CID | 71241828 |
| Molecular Formula | C24H33NO3S |
| Molecular Weight | 415.60 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (3R,5R)-3-butyl-3,8-diethyl-7-methoxy-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine 1,1-dioxide |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CC)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C24H33NO3S/c1-5-8-14-24(7-3)17-29(26,27)22-15-18(6-2)21(28-4)16-20(22)23(25-24)19-12-10-9-11-13-19/h9-13,15-16,23,25H,5-8,14,17H2,1-4H3/t23-,24-/m1/s1 |
| InChIKey | DYNJCBHXKBPNII-DNQXCXABSA-N |
| XLogP | 5.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.60 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |