About 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide
4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 71241870) has the molecular formula C10H19NO2S
and a molecular weight of 217.33 g/mol. Its IUPAC name is 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 71241870 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | CCC/C=C/CN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H19NO2S/c1-2-3-4-5-6-11-7-9-14(12,13)10-8-11/h4-5H,2-3,6-10H2,1H3/b5-4+ |
| InChIKey | HNPWYUYLRCZYQT-SNAWJCMRSA-N |
| XLogP | 1.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide?
The IUPAC name of 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide (CID 71241870) is 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide is CCC/C=C/CN1CCS(=O)(=O)CC1.
What is the InChIKey of 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide?
The InChIKey is HNPWYUYLRCZYQT-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H19NO2S/c1-2-3-4-5-6-11-7-9-14(12,13)10-8-11/h4-5H,2-3,6-10H2,1H3/b5-4+.
What are the key properties of 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide?
4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide has a molecular weight of 217.33 g/mol, XLogP of 1.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-hex-2-enyl]-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 71241870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).