About (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one
(5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one (PubChem CID 71241895) has the molecular formula C21H20N2O5
and a molecular weight of 380.40 g/mol. Its IUPAC name is (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one |
| PubChem CID | 71241895 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(-c2cc(OC[C@H]3CNC(=O)O3)c3cccnc3c2)cc1OC |
| InChI | InChI=1S/C21H20N2O5/c1-25-18-6-5-13(9-20(18)26-2)14-8-17-16(4-3-7-22-17)19(10-14)27-12-15-11-23-21(24)28-15/h3-10,15H,11-12H2,1-2H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | ZMDIGBNFHYITEJ-OAHLLOKOSA-N |
| XLogP | 3.41 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one?
The IUPAC name of (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one (CID 71241895) is (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one?
The canonical SMILES for (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one is COc1ccc(-c2cc(OC[C@H]3CNC(=O)O3)c3cccnc3c2)cc1OC.
What is the InChIKey of (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one?
The InChIKey is ZMDIGBNFHYITEJ-OAHLLOKOSA-N. The full InChI is InChI=1S/C21H20N2O5/c1-25-18-6-5-13(9-20(18)26-2)14-8-17-16(4-3-7-22-17)19(10-14)27-12-15-11-23-21(24)28-15/h3-10,15H,11-12H2,1-2H3,(H,23,24)/t15-/m1/s1.
What are the key properties of (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one?
(5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one has a molecular weight of 380.40 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[[7-(3,4-dimethoxyphenyl)quinolin-5-yl]oxymethyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 71241895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).