C23H24N2O5 — CID 71241931
(4R)-4-[[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one (PubChem CID 71241931) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is (4R)-4-[[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 71241931 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (4R)-4-[[7-(3,4,5-trimethoxyphenyl)quinolin-5-yl]oxymethyl]pyrrolidin-2-one |
| SMILES | COc1cc(-c2cc(OC[C@H]3CNC(=O)C3)c3cccnc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N2O5/c1-27-20-10-16(11-21(28-2)23(20)29-3)15-8-18-17(5-4-6-24-18)19(9-15)30-13-14-7-22(26)25-12-14/h4-6,8-11,14H,7,12-13H2,1-3H3,(H,25,26)/t14-/m1/s1 |
| InChIKey | OHHZYUSXGHQATD-CQSZACIVSA-N |
| XLogP | 3.44 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |