C18H18F2N2O — CID 71242009
4-(3,4-difluorophenyl)-N-ethyl-2,2-dimethyl-1,3-benzoxazin-7-amine (PubChem CID 71242009) has the molecular formula C18H18F2N2O and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N-ethyl-2,2-dimethyl-1,3-benzoxazin-7-amine.
| Compound Name | 4-(3,4-difluorophenyl)-N-ethyl-2,2-dimethyl-1,3-benzoxazin-7-amine |
|---|---|
| PubChem CID | 71242009 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N-ethyl-2,2-dimethyl-1,3-benzoxazin-7-amine |
| SMILES | CCNc1ccc2c(c1)OC(C)(C)N=C2c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H18F2N2O/c1-4-21-12-6-7-13-16(10-12)23-18(2,3)22-17(13)11-5-8-14(19)15(20)9-11/h5-10,21H,4H2,1-3H3 |
| InChIKey | WQPMWSXTPWTCEJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |