About 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene
5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene (PubChem CID 71242156) has the molecular formula C11H8F4S
and a molecular weight of 248.24 g/mol. Its IUPAC name is 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene.
Molecular Properties
| Compound Name | 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene |
| PubChem CID | 71242156 |
| Molecular Formula | C11H8F4S |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene |
| SMILES | Cc1c(F)c(C(F)(F)F)c(C)c2cscc12 |
| InChI | InChI=1S/C11H8F4S/c1-5-7-3-16-4-8(7)6(2)10(12)9(5)11(13,14)15/h3-4H,1-2H3 |
| InChIKey | BUSUDMBLDOBJCB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene?
The IUPAC name of 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene (CID 71242156) is 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene.
What is the SMILES notation for 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene?
The canonical SMILES for 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene is Cc1c(F)c(C(F)(F)F)c(C)c2cscc12.
What is the InChIKey of 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene?
The InChIKey is BUSUDMBLDOBJCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F4S/c1-5-7-3-16-4-8(7)6(2)10(12)9(5)11(13,14)15/h3-4H,1-2H3.
What are the key properties of 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene?
5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene has a molecular weight of 248.24 g/mol, XLogP of 4.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4,7-dimethyl-6-(trifluoromethyl)-2-benzothiophene is sourced from PubChem (CID 71242156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).