About (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid
(4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid (PubChem CID 71242200) has the molecular formula C6H4B2F2N2O5
and a molecular weight of 243.73 g/mol. Its IUPAC name is (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid.
Molecular Properties
| Compound Name | (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid |
| PubChem CID | 71242200 |
| Molecular Formula | C6H4B2F2N2O5 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid |
| SMILES | OB(O)c1c(F)c(F)c(B(O)O)c2nonc12 |
| InChI | InChI=1S/C6H4B2F2N2O5/c9-3-1(7(13)14)5-6(12-17-11-5)2(4(3)10)8(15)16/h13-16H |
| InChIKey | BQIDCXUWMOODEA-UHFFFAOYSA-N |
| XLogP | -3.14 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid?
The IUPAC name of (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid (CID 71242200) is (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid.
What is the SMILES notation for (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid?
The canonical SMILES for (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid is OB(O)c1c(F)c(F)c(B(O)O)c2nonc12.
What is the InChIKey of (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid?
The InChIKey is BQIDCXUWMOODEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4B2F2N2O5/c9-3-1(7(13)14)5-6(12-17-11-5)2(4(3)10)8(15)16/h13-16H.
What are the key properties of (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid?
(4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid has a molecular weight of 243.73 g/mol, XLogP of -3.14, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-borono-5,6-difluoro-2,1,3-benzoxadiazol-7-yl)boronic acid is sourced from PubChem (CID 71242200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).