(4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid

C6H5B2FN2O5 — CID 71242207

IUPAC(4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid
SMILESOB(O)c1cc(F)c(B(O)O)c2nonc12
InChIInChI=1S/C6H5B2FN2O5/c9-3-1-2(7(12)13)5-6(11-16-10-5)4(3)8(14)15/h1,12-15H
InChIKeyFHFIWRRRXXIHIZ-UHFFFAOYSA-N
MW225.74 g/mol
LogP-3.28
Rot. Bonds2

About (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid

(4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid (PubChem CID 71242207) has the molecular formula C6H5B2FN2O5 and a molecular weight of 225.74 g/mol. Its IUPAC name is (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid.

Molecular Properties

Compound Name(4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid
PubChem CID71242207
Molecular FormulaC6H5B2FN2O5
Molecular Weight225.74 g/mol
Exact Mass226.04
IUPAC Name(4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid
SMILESOB(O)c1cc(F)c(B(O)O)c2nonc12
InChIInChI=1S/C6H5B2FN2O5/c9-3-1-2(7(12)13)5-6(11-16-10-5)4(3)8(14)15/h1,12-15H
InChIKeyFHFIWRRRXXIHIZ-UHFFFAOYSA-N
XLogP-3.28
TPSA119.84 Ų
H-Bond Donors4
H-Bond Acceptors7
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.74
LogP ≤ 5-3.28
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid?
The IUPAC name of (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid (CID 71242207) is (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid.
What is the SMILES notation for (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid?
The canonical SMILES for (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid is OB(O)c1cc(F)c(B(O)O)c2nonc12.
What is the InChIKey of (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid?
The InChIKey is FHFIWRRRXXIHIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5B2FN2O5/c9-3-1-2(7(12)13)5-6(11-16-10-5)4(3)8(14)15/h1,12-15H.
What are the key properties of (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid?
(4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid has a molecular weight of 225.74 g/mol, XLogP of -3.28, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-borono-5-fluoro-2,1,3-benzoxadiazol-7-yl)boronic acid is sourced from PubChem (CID 71242207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).