About 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene
1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene (PubChem CID 71242563) has the molecular formula C16H17F3O
and a molecular weight of 282.31 g/mol. Its IUPAC name is 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene.
Molecular Properties
| Compound Name | 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene |
| PubChem CID | 71242563 |
| Molecular Formula | C16H17F3O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene |
| SMILES | CC(Cc1cccc2ccccc12)OCCC(F)(F)F |
| InChI | InChI=1S/C16H17F3O/c1-12(20-10-9-16(17,18)19)11-14-7-4-6-13-5-2-3-8-15(13)14/h2-8,12H,9-11H2,1H3 |
| InChIKey | PIRXPWRZAPXBJE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene?
The IUPAC name of 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene (CID 71242563) is 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene.
What is the SMILES notation for 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene?
The canonical SMILES for 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene is CC(Cc1cccc2ccccc12)OCCC(F)(F)F.
What is the InChIKey of 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene?
The InChIKey is PIRXPWRZAPXBJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F3O/c1-12(20-10-9-16(17,18)19)11-14-7-4-6-13-5-2-3-8-15(13)14/h2-8,12H,9-11H2,1H3.
What are the key properties of 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene?
1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene has a molecular weight of 282.31 g/mol, XLogP of 4.74, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,3,3-trifluoropropoxy)propyl]naphthalene is sourced from PubChem (CID 71242563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).