C19H21ClN2O3 — CID 71243030
methyl 4-[(1R)-1-[[2-amino-2-(3-chlorophenyl)acetyl]amino]propyl]benzoate (PubChem CID 71243030) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is methyl 4-[(1R)-1-[[2-amino-2-(3-chlorophenyl)acetyl]amino]propyl]benzoate.
| Compound Name | methyl 4-[(1R)-1-[[2-amino-2-(3-chlorophenyl)acetyl]amino]propyl]benzoate |
|---|---|
| PubChem CID | 71243030 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | methyl 4-[(1R)-1-[[2-amino-2-(3-chlorophenyl)acetyl]amino]propyl]benzoate |
| SMILES | CC[C@@H](NC(=O)C(N)c1cccc(Cl)c1)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-3-16(12-7-9-13(10-8-12)19(24)25-2)22-18(23)17(21)14-5-4-6-15(20)11-14/h4-11,16-17H,3,21H2,1-2H3,(H,22,23)/t16-,17?/m1/s1 |
| InChIKey | AEPSCXFKIPVPTC-TZHYSIJRSA-N |
| XLogP | 3.39 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |