C19H12N4 — CID 71243200
2-(1H-indazol-3-yl)-1,10-phenanthroline (PubChem CID 71243200) has the molecular formula C19H12N4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(1H-indazol-3-yl)-1,10-phenanthroline.
| Compound Name | 2-(1H-indazol-3-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 71243200 |
| Molecular Formula | C19H12N4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-(1H-indazol-3-yl)-1,10-phenanthroline |
| SMILES | c1cnc2c(c1)ccc1ccc(-c3n[nH]c4ccccc34)nc12 |
| InChI | InChI=1S/C19H12N4/c1-2-6-15-14(5-1)19(23-22-15)16-10-9-13-8-7-12-4-3-11-20-17(12)18(13)21-16/h1-11H,(H,22,23) |
| InChIKey | PXTUBWLBCGDFSE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|