C29H36BrF3O2 — CID 71243315
(5R,11R,13S,17S)-11-(4-bromophenyl)-13-methyl-17-(trifluoromethyl)spiro[2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,1'-cyclopentane]-5,17-diol (PubChem CID 71243315) has the molecular formula C29H36BrF3O2 and a molecular weight of 553.50 g/mol. Its IUPAC name is (5R,11R,13S,17S)-11-(4-bromophenyl)-13-methyl-17-(trifluoromethyl)spiro[2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,1'-cyclopentane]-5,17-diol.
| Compound Name | (5R,11R,13S,17S)-11-(4-bromophenyl)-13-methyl-17-(trifluoromethyl)spiro[2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,1'-cyclopentane]-5,17-diol |
|---|---|
| PubChem CID | 71243315 |
| Molecular Formula | C29H36BrF3O2 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | (5R,11R,13S,17S)-11-(4-bromophenyl)-13-methyl-17-(trifluoromethyl)spiro[2,4,6,7,8,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,1'-cyclopentane]-5,17-diol |
| SMILES | C[C@]12C[C@H](c3ccc(Br)cc3)C3=C4CCC5(CCCC5)C[C@]4(O)CCC3C1CC[C@@]2(O)C(F)(F)F |
| InChI | InChI=1S/C29H36BrF3O2/c1-25-16-21(18-4-6-19(30)7-5-18)24-20(22(25)10-15-28(25,35)29(31,32)33)8-14-27(34)17-26(11-2-3-12-26)13-9-23(24)27/h4-7,20-22,34-35H,2-3,8-17H2,1H3/t20?,21-,22?,25+,27-,28+/m1/s1 |
| InChIKey | GNZFGSKCWMUREC-DEMZEERNSA-N |
| XLogP | 7.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|