About ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate
ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate (PubChem CID 71243734) has the molecular formula C26H29FN2O2
and a molecular weight of 420.53 g/mol. Its IUPAC name is ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate |
| PubChem CID | 71243734 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(Nc2nc3ccc(F)cc3cc2C)C2CC(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H29FN2O2/c1-5-31-25(30)18-8-6-17(7-9-18)23(20-14-26(3,4)15-20)29-24-16(2)12-19-13-21(27)10-11-22(19)28-24/h6-13,20,23H,5,14-15H2,1-4H3,(H,28,29) |
| InChIKey | IPFXYFOOKRZKGE-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate?
The IUPAC name of ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate (CID 71243734) is ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate.
What is the SMILES notation for ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate?
The canonical SMILES for ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate is CCOC(=O)c1ccc(C(Nc2nc3ccc(F)cc3cc2C)C2CC(C)(C)C2)cc1.
What is the InChIKey of ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate?
The InChIKey is IPFXYFOOKRZKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29FN2O2/c1-5-31-25(30)18-8-6-17(7-9-18)23(20-14-26(3,4)15-20)29-24-16(2)12-19-13-21(27)10-11-22(19)28-24/h6-13,20,23H,5,14-15H2,1-4H3,(H,28,29).
What are the key properties of ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate?
ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate has a molecular weight of 420.53 g/mol, XLogP of 6.45, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(3,3-dimethylcyclobutyl)-[(6-fluoro-3-methylquinolin-2-yl)amino]methyl]benzoate is sourced from PubChem (CID 71243734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).