C34H35N9O — CID 71244265
6-[1-[2-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 71244265) has the molecular formula C34H35N9O and a molecular weight of 585.72 g/mol. Its IUPAC name is 6-[1-[2-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[2-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71244265 |
| Molecular Formula | C34H35N9O |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | 6-[1-[2-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)CNc1nc(NCC(C)C)nc(-c2cn(-c3ccccc3-c3nc(-c4ccccc4)c(-c4ccccc4)o3)nn2)n1 |
| InChI | InChI=1S/C34H35N9O/c1-22(2)19-35-33-38-31(39-34(40-33)36-20-23(3)4)27-21-43(42-41-27)28-18-12-11-17-26(28)32-37-29(24-13-7-5-8-14-24)30(44-32)25-15-9-6-10-16-25/h5-18,21-23H,19-20H2,1-4H3,(H2,35,36,38,39,40) |
| InChIKey | BABTVMAIKPBBBG-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |