C35H37N9O — CID 71244267
6-[1-[[4-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]methyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine (PubChem CID 71244267) has the molecular formula C35H37N9O and a molecular weight of 599.74 g/mol. Its IUPAC name is 6-[1-[[4-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]methyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[[4-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]methyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71244267 |
| Molecular Formula | C35H37N9O |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | 6-[1-[[4-(4,5-diphenyl-1,3-oxazol-2-yl)phenyl]methyl]triazol-4-yl]-2-N,4-N-bis(2-methylpropyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)CNc1nc(NCC(C)C)nc(-c2cn(Cc3ccc(-c4nc(-c5ccccc5)c(-c5ccccc5)o4)cc3)nn2)n1 |
| InChI | InChI=1S/C35H37N9O/c1-23(2)19-36-34-39-32(40-35(41-34)37-20-24(3)4)29-22-44(43-42-29)21-25-15-17-28(18-16-25)33-38-30(26-11-7-5-8-12-26)31(45-33)27-13-9-6-10-14-27/h5-18,22-24H,19-21H2,1-4H3,(H2,36,37,39,40,41) |
| InChIKey | UNAYAFXRTIIIJQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |