C33H41N9O — CID 71244272
6-[1-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propyl]triazol-4-yl]-2-N,4-N-bis(3-methylbutyl)-1,3,5-triazine-2,4-diamine (PubChem CID 71244272) has the molecular formula C33H41N9O and a molecular weight of 579.75 g/mol. Its IUPAC name is 6-[1-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propyl]triazol-4-yl]-2-N,4-N-bis(3-methylbutyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propyl]triazol-4-yl]-2-N,4-N-bis(3-methylbutyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71244272 |
| Molecular Formula | C33H41N9O |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.34 |
| IUPAC Name | 6-[1-[3-(4,5-diphenyl-1,3-oxazol-2-yl)propyl]triazol-4-yl]-2-N,4-N-bis(3-methylbutyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)CCNc1nc(NCCC(C)C)nc(-c2cn(CCCc3nc(-c4ccccc4)c(-c4ccccc4)o3)nn2)n1 |
| InChI | InChI=1S/C33H41N9O/c1-23(2)17-19-34-32-37-31(38-33(39-32)35-20-18-24(3)4)27-22-42(41-40-27)21-11-16-28-36-29(25-12-7-5-8-13-25)30(43-28)26-14-9-6-10-15-26/h5-10,12-15,22-24H,11,16-21H2,1-4H3,(H2,34,35,37,38,39) |
| InChIKey | SPTOLEISRDRIAD-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |