C25H42F2N2O4 — CID 71244522
(Z)-2-fluoro-N-[(1S,2R)-2-[[(Z)-2-fluoro-11-hydroxyundec-2-enoyl]amino]cyclopropyl]-11-hydroxyundec-2-enamide (PubChem CID 71244522) has the molecular formula C25H42F2N2O4 and a molecular weight of 472.62 g/mol. Its IUPAC name is (Z)-2-fluoro-N-[(1S,2R)-2-[[(Z)-2-fluoro-11-hydroxyundec-2-enoyl]amino]cyclopropyl]-11-hydroxyundec-2-enamide.
| Compound Name | (Z)-2-fluoro-N-[(1S,2R)-2-[[(Z)-2-fluoro-11-hydroxyundec-2-enoyl]amino]cyclopropyl]-11-hydroxyundec-2-enamide |
|---|---|
| PubChem CID | 71244522 |
| Molecular Formula | C25H42F2N2O4 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | (Z)-2-fluoro-N-[(1S,2R)-2-[[(Z)-2-fluoro-11-hydroxyundec-2-enoyl]amino]cyclopropyl]-11-hydroxyundec-2-enamide |
| SMILES | O=C(N[C@H]1C[C@H]1NC(=O)/C(F)=C/CCCCCCCCO)/C(F)=C/CCCCCCCCO |
| InChI | InChI=1S/C25H42F2N2O4/c26-20(15-11-7-3-1-5-9-13-17-30)24(32)28-22-19-23(22)29-25(33)21(27)16-12-8-4-2-6-10-14-18-31/h15-16,22-23,30-31H,1-14,17-19H2,(H,28,32)(H,29,33)/b20-15-,21-16-/t22-,23+ |
| InChIKey | AZZPJTRSYDAIGA-AJCHPTQQSA-N |
| XLogP | 4.51 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|