C29H50F2N2O4 — CID 71244536
(Z)-2-fluoro-N-[(1R,2S)-2-[[(Z)-2-fluoro-13-hydroxytridec-2-enoyl]amino]cyclopropyl]-13-hydroxytridec-2-enamide (PubChem CID 71244536) has the molecular formula C29H50F2N2O4 and a molecular weight of 528.73 g/mol. Its IUPAC name is (Z)-2-fluoro-N-[(1R,2S)-2-[[(Z)-2-fluoro-13-hydroxytridec-2-enoyl]amino]cyclopropyl]-13-hydroxytridec-2-enamide.
| Compound Name | (Z)-2-fluoro-N-[(1R,2S)-2-[[(Z)-2-fluoro-13-hydroxytridec-2-enoyl]amino]cyclopropyl]-13-hydroxytridec-2-enamide |
|---|---|
| PubChem CID | 71244536 |
| Molecular Formula | C29H50F2N2O4 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | (Z)-2-fluoro-N-[(1R,2S)-2-[[(Z)-2-fluoro-13-hydroxytridec-2-enoyl]amino]cyclopropyl]-13-hydroxytridec-2-enamide |
| SMILES | O=C(N[C@H]1C[C@H]1NC(=O)/C(F)=C/CCCCCCCCCCO)/C(F)=C/CCCCCCCCCCO |
| InChI | InChI=1S/C29H50F2N2O4/c30-24(19-15-11-7-3-1-5-9-13-17-21-34)28(36)32-26-23-27(26)33-29(37)25(31)20-16-12-8-4-2-6-10-14-18-22-35/h19-20,26-27,34-35H,1-18,21-23H2,(H,32,36)(H,33,37)/b24-19-,25-20-/t26-,27+ |
| InChIKey | VBGIHKBZMQHCSR-YGLOQNFLSA-N |
| XLogP | 6.07 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|