(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid

C13H21FO4 — CID 71244545

IUPAC(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid
SMILESO=C(O)/C(F)=C/CCCCCOC1CCCCO1
InChIInChI=1S/C13H21FO4/c14-11(13(15)16)7-3-1-2-5-9-17-12-8-4-6-10-18-12/h7,12H,1-6,8-10H2,(H,15,16)/b11-7-
InChIKeyHELMWKWGCJLJHK-XFFZJAGNSA-N
MW260.30 g/mol
LogP3.03
Rot. Bonds8

About (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid

(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid (PubChem CID 71244545) has the molecular formula C13H21FO4 and a molecular weight of 260.30 g/mol. Its IUPAC name is (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid.

Molecular Properties

Compound Name(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid
PubChem CID71244545
Molecular FormulaC13H21FO4
Molecular Weight260.30 g/mol
Exact Mass260.14
IUPAC Name(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid
SMILESO=C(O)/C(F)=C/CCCCCOC1CCCCO1
InChIInChI=1S/C13H21FO4/c14-11(13(15)16)7-3-1-2-5-9-17-12-8-4-6-10-18-12/h7,12H,1-6,8-10H2,(H,15,16)/b11-7-
InChIKeyHELMWKWGCJLJHK-XFFZJAGNSA-N
XLogP3.03
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.30
LogP ≤ 53.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

ethyl (Z)-2-fluoro-6-(oxan-2-yloxy)hex-2-enoate
CID 10825238
(Z)-2-fluoro-6-(oxan-2-yloxy)hex-2-enoic acid
CID 69854996
(E)-2-fluoro-6-(oxan-2-yloxy)hex-2-enoic acid
CID 69854997
2-Fluoro-6-(oxan-2-yloxy)hex-2-enoic acid
CID 69854998
2-Fluoro-8-(oxan-2-yloxy)oct-2-enoic acid
CID 78045890
ethyl (Z)-2-fluoro-6-[(2R)-oxan-2-yl]oxyhex-2-enoate
CID 129363766
ethyl (Z)-2-fluoro-6-[(2S)-oxan-2-yl]oxyhex-2-enoate
CID 129363767
(E)-10-(oxan-2-yloxy)dec-2-enoic acid
CID 11207964
(E)-5-(oxan-2-yloxy)pent-2-enoic acid
CID 59586995
5-(Tetrahydro-pyran-2-yloxy)-pent-2-enoic acid
CID 66876752
5-(6-Methoxyoxan-2-yl)oxypent-2-enoic acid
CID 67894223
6-(1,3-Dioxan-2-yl)hex-2-enoic acid
CID 67935973

Frequently Asked Questions

What is the IUPAC name of (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid?
The IUPAC name of (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid (CID 71244545) is (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid.
What is the SMILES notation for (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid?
The canonical SMILES for (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid is O=C(O)/C(F)=C/CCCCCOC1CCCCO1.
What is the InChIKey of (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid?
The InChIKey is HELMWKWGCJLJHK-XFFZJAGNSA-N. The full InChI is InChI=1S/C13H21FO4/c14-11(13(15)16)7-3-1-2-5-9-17-12-8-4-6-10-18-12/h7,12H,1-6,8-10H2,(H,15,16)/b11-7-.
What are the key properties of (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid?
(Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid has a molecular weight of 260.30 g/mol, XLogP of 3.03, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-fluoro-8-(oxan-2-yloxy)oct-2-enoic acid is sourced from PubChem (CID 71244545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).