C16H15FN6O — CID 71245061
3-[[6-[1-(5-fluoro-2-pyridinyl)ethylamino]pyrazin-2-yl]amino]-1H-pyridin-2-one (PubChem CID 71245061) has the molecular formula C16H15FN6O and a molecular weight of 326.34 g/mol. Its IUPAC name is 3-[[6-[1-(5-fluoro-2-pyridinyl)ethylamino]pyrazin-2-yl]amino]-1H-pyridin-2-one.
| Compound Name | 3-[[6-[1-(5-fluoro-2-pyridinyl)ethylamino]pyrazin-2-yl]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 71245061 |
| Molecular Formula | C16H15FN6O |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-[[6-[1-(5-fluoro-2-pyridinyl)ethylamino]pyrazin-2-yl]amino]-1H-pyridin-2-one |
| SMILES | CC(Nc1cncc(Nc2ccc[nH]c2=O)n1)c1ccc(F)cn1 |
| InChI | InChI=1S/C16H15FN6O/c1-10(12-5-4-11(17)7-20-12)21-14-8-18-9-15(23-14)22-13-3-2-6-19-16(13)24/h2-10H,1H3,(H,19,24)(H2,21,22,23) |
| InChIKey | PBNAOZZCLQUYFY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |