C18H18ClFN2O5 — CID 71245926
[3-(3-chloro-4-fluorophenoxy)-2-nitrophenyl]-(2,2-dimethylpropyl)carbamic acid (PubChem CID 71245926) has the molecular formula C18H18ClFN2O5 and a molecular weight of 396.80 g/mol. Its IUPAC name is [3-(3-chloro-4-fluorophenoxy)-2-nitrophenyl]-(2,2-dimethylpropyl)carbamic acid.
| Compound Name | [3-(3-chloro-4-fluorophenoxy)-2-nitrophenyl]-(2,2-dimethylpropyl)carbamic acid |
|---|---|
| PubChem CID | 71245926 |
| Molecular Formula | C18H18ClFN2O5 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [3-(3-chloro-4-fluorophenoxy)-2-nitrophenyl]-(2,2-dimethylpropyl)carbamic acid |
| SMILES | CC(C)(C)CN(C(=O)O)c1cccc(Oc2ccc(F)c(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18ClFN2O5/c1-18(2,3)10-21(17(23)24)14-5-4-6-15(16(14)22(25)26)27-11-7-8-13(20)12(19)9-11/h4-9H,10H2,1-3H3,(H,23,24) |
| InChIKey | KJBBIOFVLNETSI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|