C16H20N6O3 — CID 71246113
3-[[2-[(2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]amino]piperidine-1-carboxylic acid (PubChem CID 71246113) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is 3-[[2-[(2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]amino]piperidine-1-carboxylic acid.
| Compound Name | 3-[[2-[(2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 71246113 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 3-[[2-[(2-methoxy-3-pyridinyl)amino]pyrimidin-4-yl]amino]piperidine-1-carboxylic acid |
| SMILES | COc1ncccc1Nc1nccc(NC2CCCN(C(=O)O)C2)n1 |
| InChI | InChI=1S/C16H20N6O3/c1-25-14-12(5-2-7-17-14)20-15-18-8-6-13(21-15)19-11-4-3-9-22(10-11)16(23)24/h2,5-8,11H,3-4,9-10H2,1H3,(H,23,24)(H2,18,19,20,21) |
| InChIKey | KQMDGMYBSBQHCV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |