C34H27Cl2FN2O2 — CID 71246375
3-(2,4-dichloro-5-fluorophenyl)-2-[4-[(2-methyl-3-pyridinyl)methoxy]phenyl]-N,3-diphenylpropanamide (PubChem CID 71246375) has the molecular formula C34H27Cl2FN2O2 and a molecular weight of 585.51 g/mol. Its IUPAC name is 3-(2,4-dichloro-5-fluorophenyl)-2-[4-[(2-methyl-3-pyridinyl)methoxy]phenyl]-N,3-diphenylpropanamide.
| Compound Name | 3-(2,4-dichloro-5-fluorophenyl)-2-[4-[(2-methyl-3-pyridinyl)methoxy]phenyl]-N,3-diphenylpropanamide |
|---|---|
| PubChem CID | 71246375 |
| Molecular Formula | C34H27Cl2FN2O2 |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 584.14 |
| IUPAC Name | 3-(2,4-dichloro-5-fluorophenyl)-2-[4-[(2-methyl-3-pyridinyl)methoxy]phenyl]-N,3-diphenylpropanamide |
| SMILES | Cc1ncccc1COc1ccc(C(C(=O)Nc2ccccc2)C(c2ccccc2)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C34H27Cl2FN2O2/c1-22-25(11-8-18-38-22)21-41-27-16-14-24(15-17-27)33(34(40)39-26-12-6-3-7-13-26)32(23-9-4-2-5-10-23)28-19-31(37)30(36)20-29(28)35/h2-20,32-33H,21H2,1H3,(H,39,40) |
| InChIKey | YAOGSUZQKHJFTA-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|