C18H16F2N2O2 — CID 71246699
(E)-2,3-bis(3-fluoro-4-methylphenyl)but-2-enediamide (PubChem CID 71246699) has the molecular formula C18H16F2N2O2 and a molecular weight of 330.33 g/mol. Its IUPAC name is (E)-2,3-bis(3-fluoro-4-methylphenyl)but-2-enediamide.
| Compound Name | (E)-2,3-bis(3-fluoro-4-methylphenyl)but-2-enediamide |
|---|---|
| PubChem CID | 71246699 |
| Molecular Formula | C18H16F2N2O2 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (E)-2,3-bis(3-fluoro-4-methylphenyl)but-2-enediamide |
| SMILES | Cc1ccc(/C(C(N)=O)=C(\C(N)=O)c2ccc(C)c(F)c2)cc1F |
| InChI | InChI=1S/C18H16F2N2O2/c1-9-3-5-11(7-13(9)19)15(17(21)23)16(18(22)24)12-6-4-10(2)14(20)8-12/h3-8H,1-2H3,(H2,21,23)(H2,22,24)/b16-15+ |
| InChIKey | RPORQXILRNFCST-FOCLMDBBSA-N |
| XLogP | 2.46 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|