About 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid
2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid (PubChem CID 71246766) has the molecular formula C14H14FN3O3
and a molecular weight of 291.28 g/mol. Its IUPAC name is 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid.
Molecular Properties
| Compound Name | 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid |
| PubChem CID | 71246766 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2cnc(N[C@H]3CCOC[C@H]3F)nc2c1 |
| InChI | InChI=1S/C14H14FN3O3/c15-10-7-21-4-3-11(10)17-14-16-6-9-2-1-8(13(19)20)5-12(9)18-14/h1-2,5-6,10-11H,3-4,7H2,(H,19,20)(H,16,17,18)/t10-,11+/m1/s1 |
| InChIKey | UAAZNFCKBHKWRQ-MNOVXSKESA-N |
| XLogP | 1.87 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid?
The IUPAC name of 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid (CID 71246766) is 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid.
What is the SMILES notation for 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid?
The canonical SMILES for 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid is O=C(O)c1ccc2cnc(N[C@H]3CCOC[C@H]3F)nc2c1.
What is the InChIKey of 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid?
The InChIKey is UAAZNFCKBHKWRQ-MNOVXSKESA-N. The full InChI is InChI=1S/C14H14FN3O3/c15-10-7-21-4-3-11(10)17-14-16-6-9-2-1-8(13(19)20)5-12(9)18-14/h1-2,5-6,10-11H,3-4,7H2,(H,19,20)(H,16,17,18)/t10-,11+/m1/s1.
What are the key properties of 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid?
2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid has a molecular weight of 291.28 g/mol, XLogP of 1.87, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3S,4S)-3-fluorooxan-4-yl]amino]quinazoline-7-carboxylic acid is sourced from PubChem (CID 71246766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).