C15H14N2O3 — CID 712476
(5S,6R)-6-naphthalen-1-yl-5-nitropiperidin-2-one (PubChem CID 712476) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is (5S,6R)-6-naphthalen-1-yl-5-nitropiperidin-2-one.
| Compound Name | (5S,6R)-6-naphthalen-1-yl-5-nitropiperidin-2-one |
|---|---|
| PubChem CID | 712476 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (5S,6R)-6-naphthalen-1-yl-5-nitropiperidin-2-one |
| SMILES | O=C1CC[C@H]([N+](=O)[O-])[C@@H](c2cccc3ccccc23)N1 |
| InChI | InChI=1S/C15H14N2O3/c18-14-9-8-13(17(19)20)15(16-14)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13,15H,8-9H2,(H,16,18)/t13-,15+/m0/s1 |
| InChIKey | VSTQRSGTVPVEOS-DZGCQCFKSA-N |
| XLogP | 2.44 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|