About 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline
3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline (PubChem CID 71248614) has the molecular formula C16H20N2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline.
Molecular Properties
| Compound Name | 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline |
| PubChem CID | 71248614 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline |
| SMILES | CCC1=C(C)N(C)C2(C)C=c3ccccc3=CN12 |
| InChI | InChI=1S/C16H20N2/c1-5-15-12(2)17(4)16(3)10-13-8-6-7-9-14(13)11-18(15)16/h6-11H,5H2,1-4H3 |
| InChIKey | WFVLJOYTWBMSIA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline?
The IUPAC name of 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline (CID 71248614) is 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline.
What is the SMILES notation for 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline?
The canonical SMILES for 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline is CCC1=C(C)N(C)C2(C)C=c3ccccc3=CN12.
What is the InChIKey of 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline?
The InChIKey is WFVLJOYTWBMSIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2/c1-5-15-12(2)17(4)16(3)10-13-8-6-7-9-14(13)11-18(15)16/h6-11H,5H2,1-4H3.
What are the key properties of 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline?
3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline has a molecular weight of 240.35 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2,10a-trimethylimidazo[1,2-b]isoquinoline is sourced from PubChem (CID 71248614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).