C33H27NO — CID 71248620
(4aR)-9-dibenzofuran-2-yl-6-(2,4,6-trimethylphenyl)-4a,9a-dihydrocarbazole (PubChem CID 71248620) has the molecular formula C33H27NO and a molecular weight of 453.59 g/mol. Its IUPAC name is (4aR)-9-dibenzofuran-2-yl-6-(2,4,6-trimethylphenyl)-4a,9a-dihydrocarbazole.
| Compound Name | (4aR)-9-dibenzofuran-2-yl-6-(2,4,6-trimethylphenyl)-4a,9a-dihydrocarbazole |
|---|---|
| PubChem CID | 71248620 |
| Molecular Formula | C33H27NO |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (4aR)-9-dibenzofuran-2-yl-6-(2,4,6-trimethylphenyl)-4a,9a-dihydrocarbazole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)[C@H]2C=CC=CC2N3c2ccc3oc4ccccc4c3c2)c(C)c1 |
| InChI | InChI=1S/C33H27NO/c1-20-16-21(2)33(22(3)17-20)23-12-14-30-27(18-23)25-8-4-6-10-29(25)34(30)24-13-15-32-28(19-24)26-9-5-7-11-31(26)35-32/h4-19,25,29H,1-3H3/t25-,29?/m1/s1 |
| InChIKey | BGBSTYVSXSSORW-MIJJZIGMSA-N |
| XLogP | 8.91 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |