C22H34F2O6 — CID 71248687
[1-[(3aR,4R,5R)-5-(oxan-2-yloxy)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-4,4-difluorooctan-3-yl] acetate (PubChem CID 71248687) has the molecular formula C22H34F2O6 and a molecular weight of 432.50 g/mol. Its IUPAC name is [1-[(3aR,4R,5R)-5-(oxan-2-yloxy)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-4,4-difluorooctan-3-yl] acetate.
| Compound Name | [1-[(3aR,4R,5R)-5-(oxan-2-yloxy)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-4,4-difluorooctan-3-yl] acetate |
|---|---|
| PubChem CID | 71248687 |
| Molecular Formula | C22H34F2O6 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [1-[(3aR,4R,5R)-5-(oxan-2-yloxy)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-4,4-difluorooctan-3-yl] acetate |
| SMILES | CCCCC(F)(F)C(CC[C@H]1[C@H](OC2CCCCO2)CC2OC(=O)C[C@@H]21)OC(C)=O |
| InChI | InChI=1S/C22H34F2O6/c1-3-4-10-22(23,24)19(28-14(2)25)9-8-15-16-12-20(26)29-18(16)13-17(15)30-21-7-5-6-11-27-21/h15-19,21H,3-13H2,1-2H3/t15-,16-,17-,18?,19?,21?/m1/s1 |
| InChIKey | MADBINKCKHQMLB-QZHOPHHCSA-N |
| XLogP | 4.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |