About 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea
1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea (PubChem CID 71249327) has the molecular formula C18H22N6O2
and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea.
Molecular Properties
| Compound Name | 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea |
| PubChem CID | 71249327 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea |
| SMILES | O=C1CN(c2cnc3ccc(NC(=O)NC4CCCC4)nc3c2)CCN1 |
| InChI | InChI=1S/C18H22N6O2/c25-17-11-24(8-7-19-17)13-9-15-14(20-10-13)5-6-16(22-15)23-18(26)21-12-3-1-2-4-12/h5-6,9-10,12H,1-4,7-8,11H2,(H,19,25)(H2,21,22,23,26) |
| InChIKey | QWHDAIJUBVXVRL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea?
The IUPAC name of 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea (CID 71249327) is 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea.
What is the SMILES notation for 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea?
The canonical SMILES for 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea is O=C1CN(c2cnc3ccc(NC(=O)NC4CCCC4)nc3c2)CCN1.
What is the InChIKey of 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea?
The InChIKey is QWHDAIJUBVXVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N6O2/c25-17-11-24(8-7-19-17)13-9-15-14(20-10-13)5-6-16(22-15)23-18(26)21-12-3-1-2-4-12/h5-6,9-10,12H,1-4,7-8,11H2,(H,19,25)(H2,21,22,23,26).
What are the key properties of 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea?
1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea has a molecular weight of 354.41 g/mol, XLogP of 1.63, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3-[7-(3-oxopiperazin-1-yl)-1,5-naphthyridin-2-yl]urea is sourced from PubChem (CID 71249327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).