About 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine
7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine (PubChem CID 71249442) has the molecular formula C11H11N5
and a molecular weight of 213.24 g/mol. Its IUPAC name is 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine |
| PubChem CID | 71249442 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine |
| SMILES | Nc1ccc2ncc(N3C=NCC3)cc2n1 |
| InChI | InChI=1S/C11H11N5/c12-11-2-1-9-10(15-11)5-8(6-14-9)16-4-3-13-7-16/h1-2,5-7H,3-4H2,(H2,12,15) |
| InChIKey | WPMKDGFYDQNZOB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine?
The IUPAC name of 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine (CID 71249442) is 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine.
What is the SMILES notation for 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine?
The canonical SMILES for 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine is Nc1ccc2ncc(N3C=NCC3)cc2n1.
What is the InChIKey of 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine?
The InChIKey is WPMKDGFYDQNZOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5/c12-11-2-1-9-10(15-11)5-8(6-14-9)16-4-3-13-7-16/h1-2,5-7H,3-4H2,(H2,12,15).
What are the key properties of 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine?
7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine has a molecular weight of 213.24 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4,5-dihydroimidazol-1-yl)-1,5-naphthyridin-2-amine is sourced from PubChem (CID 71249442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).