About 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea
1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea (PubChem CID 71249525) has the molecular formula C18H20N6O2
and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea.
Molecular Properties
| Compound Name | 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea |
| PubChem CID | 71249525 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea |
| SMILES | O=C(NCC1CCOCC1)Nc1ccc2ncc(-c3cn[nH]c3)cc2n1 |
| InChI | InChI=1S/C18H20N6O2/c25-18(20-8-12-3-5-26-6-4-12)24-17-2-1-15-16(23-17)7-13(9-19-15)14-10-21-22-11-14/h1-2,7,9-12H,3-6,8H2,(H,21,22)(H2,20,23,24,25) |
| InChIKey | AVXGJLSPXPUZRB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea?
The IUPAC name of 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea (CID 71249525) is 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea.
What is the SMILES notation for 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea?
The canonical SMILES for 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea is O=C(NCC1CCOCC1)Nc1ccc2ncc(-c3cn[nH]c3)cc2n1.
What is the InChIKey of 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea?
The InChIKey is AVXGJLSPXPUZRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6O2/c25-18(20-8-12-3-5-26-6-4-12)24-17-2-1-15-16(23-17)7-13(9-19-15)14-10-21-22-11-14/h1-2,7,9-12H,3-6,8H2,(H,21,22)(H2,20,23,24,25).
What are the key properties of 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea?
1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea has a molecular weight of 352.40 g/mol, XLogP of 2.57, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-ylmethyl)-3-[7-(1H-pyrazol-4-yl)-1,5-naphthyridin-2-yl]urea is sourced from PubChem (CID 71249525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).