C28H25ClFN7OS — CID 71249726
6-[2-chloro-4-(1,3-thiazol-5-yl)phenyl]-8-ethyl-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 71249726) has the molecular formula C28H25ClFN7OS and a molecular weight of 562.07 g/mol. Its IUPAC name is 6-[2-chloro-4-(1,3-thiazol-5-yl)phenyl]-8-ethyl-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-[2-chloro-4-(1,3-thiazol-5-yl)phenyl]-8-ethyl-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 71249726 |
| Molecular Formula | C28H25ClFN7OS |
| Molecular Weight | 562.07 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | 6-[2-chloro-4-(1,3-thiazol-5-yl)phenyl]-8-ethyl-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccc(-c3cncs3)cc2Cl)cc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc21 |
| InChI | InChI=1S/C28H25ClFN7OS/c1-2-37-26-18(11-21(27(37)38)20-5-3-17(12-22(20)29)25-15-32-16-39-25)14-33-28(35-26)34-19-4-6-24(23(30)13-19)36-9-7-31-8-10-36/h3-6,11-16,31H,2,7-10H2,1H3,(H,33,34,35) |
| InChIKey | BAXSGIQYRPLZRP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.07 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|