C30H30FN7OS — CID 71249831
2-(3-fluoro-4-piperazin-1-ylanilino)-6-[4-methyl-2-(1,3-thiazol-2-yl)phenyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 71249831) has the molecular formula C30H30FN7OS and a molecular weight of 555.68 g/mol. Its IUPAC name is 2-(3-fluoro-4-piperazin-1-ylanilino)-6-[4-methyl-2-(1,3-thiazol-2-yl)phenyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(3-fluoro-4-piperazin-1-ylanilino)-6-[4-methyl-2-(1,3-thiazol-2-yl)phenyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 71249831 |
| Molecular Formula | C30H30FN7OS |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 2-(3-fluoro-4-piperazin-1-ylanilino)-6-[4-methyl-2-(1,3-thiazol-2-yl)phenyl]-8-propan-2-ylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1ccc(-c2cc3cnc(Nc4ccc(N5CCNCC5)c(F)c4)nc3n(C(C)C)c2=O)c(-c2nccs2)c1 |
| InChI | InChI=1S/C30H30FN7OS/c1-18(2)38-27-20(15-24(29(38)39)22-6-4-19(3)14-23(22)28-33-10-13-40-28)17-34-30(36-27)35-21-5-7-26(25(31)16-21)37-11-8-32-9-12-37/h4-7,10,13-18,32H,8-9,11-12H2,1-3H3,(H,34,35,36) |
| InChIKey | BPBLECGNMASTOK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|