C19H19N14P3 — CID 71250199
(6R)-2,2,4,4,6-penta(imidazol-1-yl)-6-pyrrol-1-yl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 71250199) has the molecular formula C19H19N14P3 and a molecular weight of 536.38 g/mol. Its IUPAC name is (6R)-2,2,4,4,6-penta(imidazol-1-yl)-6-pyrrol-1-yl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | (6R)-2,2,4,4,6-penta(imidazol-1-yl)-6-pyrrol-1-yl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 71250199 |
| Molecular Formula | C19H19N14P3 |
| Molecular Weight | 536.38 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | (6R)-2,2,4,4,6-penta(imidazol-1-yl)-6-pyrrol-1-yl-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | c1ccn([P@@]2(n3ccnc3)=NP(n3ccnc3)(n3ccnc3)=NP(n3ccnc3)(n3ccnc3)=N2)c1 |
| InChI | InChI=1S/C19H19N14P3/c1-2-9-28(8-1)34(29-10-3-20-15-29)25-35(30-11-4-21-16-30,31-12-5-22-17-31)27-36(26-34,32-13-6-23-18-32)33-14-7-24-19-33/h1-19H |
| InChIKey | WHHYWXWOGGFLST-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 131.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|