C18H30O7 — CID 71250411
methyl (2R,4R,5R)-2-acetyloxy-6-[(2R,3R)-3-acetyloxypentan-2-yl]-4,5-dimethyloxane-2-carboxylate (PubChem CID 71250411) has the molecular formula C18H30O7 and a molecular weight of 358.43 g/mol. Its IUPAC name is methyl (2R,4R,5R)-2-acetyloxy-6-[(2R,3R)-3-acetyloxypentan-2-yl]-4,5-dimethyloxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5R)-2-acetyloxy-6-[(2R,3R)-3-acetyloxypentan-2-yl]-4,5-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 71250411 |
| Molecular Formula | C18H30O7 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | methyl (2R,4R,5R)-2-acetyloxy-6-[(2R,3R)-3-acetyloxypentan-2-yl]-4,5-dimethyloxane-2-carboxylate |
| SMILES | CC[C@@H](OC(C)=O)[C@@H](C)C1O[C@](OC(C)=O)(C(=O)OC)C[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C18H30O7/c1-8-15(23-13(5)19)12(4)16-11(3)10(2)9-18(25-16,17(21)22-7)24-14(6)20/h10-12,15-16H,8-9H2,1-7H3/t10-,11-,12-,15-,16?,18+/m1/s1 |
| InChIKey | BVQGTNNAFQQZLV-DLRLRDQDSA-N |
| XLogP | 2.46 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|