C24H27N3S — CID 71250649
N-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-1-pyrrolidin-1-ylmethanimine (PubChem CID 71250649) has the molecular formula C24H27N3S and a molecular weight of 389.57 g/mol. Its IUPAC name is N-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-1-pyrrolidin-1-ylmethanimine.
| Compound Name | N-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-1-pyrrolidin-1-ylmethanimine |
|---|---|
| PubChem CID | 71250649 |
| Molecular Formula | C24H27N3S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[2,5-dimethyl-4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-1-pyrrolidin-1-ylmethanimine |
| SMILES | Cc1ccc(-c2csc(Cc3cc(C)c(/N=C/N4CCCC4)cc3C)n2)cc1 |
| InChI | InChI=1S/C24H27N3S/c1-17-6-8-20(9-7-17)23-15-28-24(26-23)14-21-12-19(3)22(13-18(21)2)25-16-27-10-4-5-11-27/h6-9,12-13,15-16H,4-5,10-11,14H2,1-3H3/b25-16+ |
| InChIKey | QRVAKROOJCTTDB-PCLIKHOPSA-N |
| XLogP | 6.08 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|