C24H24F3N3OS — CID 71250685
N'-[2,5-dimethyl-4-[[4-[4-(trifluoromethyl)benzoyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 71250685) has the molecular formula C24H24F3N3OS and a molecular weight of 459.54 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[[4-[4-(trifluoromethyl)benzoyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[[4-[4-(trifluoromethyl)benzoyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 71250685 |
| Molecular Formula | C24H24F3N3OS |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N'-[2,5-dimethyl-4-[[4-[4-(trifluoromethyl)benzoyl]-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(C(=O)c3ccc(C(F)(F)F)cc3)cs2)cc1C |
| InChI | InChI=1S/C24H24F3N3OS/c1-5-30(4)14-28-20-11-15(2)18(10-16(20)3)12-22-29-21(13-32-22)23(31)17-6-8-19(9-7-17)24(25,26)27/h6-11,13-14H,5,12H2,1-4H3/b28-14+ |
| InChIKey | BOVSWXDQXWHLEZ-CCVNUDIWSA-N |
| XLogP | 6.21 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|