C23H27N3O2S2 — CID 71250702
N'-[2,5-dimethyl-4-[[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 71250702) has the molecular formula C23H27N3O2S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 71250702 |
| Molecular Formula | C23H27N3O2S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N'-[2,5-dimethyl-4-[[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]methyl]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(-c3ccc(S(C)(=O)=O)cc3)cs2)cc1C |
| InChI | InChI=1S/C23H27N3O2S2/c1-6-26(4)15-24-21-12-16(2)19(11-17(21)3)13-23-25-22(14-29-23)18-7-9-20(10-8-18)30(5,27)28/h7-12,14-15H,6,13H2,1-5H3/b24-15+ |
| InChIKey | SEGWQPRBIUXBMU-BUVRLJJBSA-N |
| XLogP | 5.03 |
| TPSA | 62.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|